C10H8F5NO2 — CID 103528795
2-fluoro-6-hydroxy-N-(2,2,3,3-tetrafluoropropyl)benzamide (PubChem CID 103528795) has the molecular formula C10H8F5NO2 and a molecular weight of 269.17 g/mol. Its IUPAC name is 2-fluoro-6-hydroxy-N-(2,2,3,3-tetrafluoropropyl)benzamide.
| Compound Name | 2-fluoro-6-hydroxy-N-(2,2,3,3-tetrafluoropropyl)benzamide |
|---|---|
| PubChem CID | 103528795 |
| Molecular Formula | C10H8F5NO2 |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 2-fluoro-6-hydroxy-N-(2,2,3,3-tetrafluoropropyl)benzamide |
| SMILES | O=C(NCC(F)(F)C(F)F)c1c(O)cccc1F |
| InChI | InChI=1S/C10H8F5NO2/c11-5-2-1-3-6(17)7(5)8(18)16-4-10(14,15)9(12)13/h1-3,9,17H,4H2,(H,16,18) |
| InChIKey | WLXASCOUBVCQPI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|