C10H9F5N2O — CID 106291883
2-amino-3-fluoro-N-(2,2,3,3-tetrafluoropropyl)benzamide (PubChem CID 106291883) has the molecular formula C10H9F5N2O and a molecular weight of 268.18 g/mol. Its IUPAC name is 2-amino-3-fluoro-N-(2,2,3,3-tetrafluoropropyl)benzamide.
| Compound Name | 2-amino-3-fluoro-N-(2,2,3,3-tetrafluoropropyl)benzamide |
|---|---|
| PubChem CID | 106291883 |
| Molecular Formula | C10H9F5N2O |
| Molecular Weight | 268.18 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 2-amino-3-fluoro-N-(2,2,3,3-tetrafluoropropyl)benzamide |
| SMILES | Nc1c(F)cccc1C(=O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C10H9F5N2O/c11-6-3-1-2-5(7(6)16)8(18)17-4-10(14,15)9(12)13/h1-3,9H,4,16H2,(H,17,18) |
| InChIKey | YEIBUPWJNJVADY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.18 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|