C8H8F4N2OS — CID 106289141
3-amino-N-(2,2,3,3-tetrafluoropropyl)thiophene-2-carboxamide (PubChem CID 106289141) has the molecular formula C8H8F4N2OS and a molecular weight of 256.22 g/mol. Its IUPAC name is 3-amino-N-(2,2,3,3-tetrafluoropropyl)thiophene-2-carboxamide.
| Compound Name | 3-amino-N-(2,2,3,3-tetrafluoropropyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 106289141 |
| Molecular Formula | C8H8F4N2OS |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 3-amino-N-(2,2,3,3-tetrafluoropropyl)thiophene-2-carboxamide |
| SMILES | Nc1ccsc1C(=O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C8H8F4N2OS/c9-7(10)8(11,12)3-14-6(15)5-4(13)1-2-16-5/h1-2,7H,3,13H2,(H,14,15) |
| InChIKey | YJKSMHGYKVVYEX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|