C11H9F4NO2S — CID 106295344
3-(3-hydroxyprop-1-ynyl)-N-(2,2,3,3-tetrafluoropropyl)thiophene-2-carboxamide (PubChem CID 106295344) has the molecular formula C11H9F4NO2S and a molecular weight of 295.26 g/mol. Its IUPAC name is 3-(3-hydroxyprop-1-ynyl)-N-(2,2,3,3-tetrafluoropropyl)thiophene-2-carboxamide.
| Compound Name | 3-(3-hydroxyprop-1-ynyl)-N-(2,2,3,3-tetrafluoropropyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 106295344 |
| Molecular Formula | C11H9F4NO2S |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 3-(3-hydroxyprop-1-ynyl)-N-(2,2,3,3-tetrafluoropropyl)thiophene-2-carboxamide |
| SMILES | O=C(NCC(F)(F)C(F)F)c1sccc1C#CCO |
| InChI | InChI=1S/C11H9F4NO2S/c12-10(13)11(14,15)6-16-9(18)8-7(2-1-4-17)3-5-19-8/h3,5,10,17H,4,6H2,(H,16,18) |
| InChIKey | QDDDCAASEURASD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|