C14H13F4NO2 — CID 106295346
2-(3-hydroxyprop-1-ynyl)-4-methyl-N-(2,2,3,3-tetrafluoropropyl)benzamide (PubChem CID 106295346) has the molecular formula C14H13F4NO2 and a molecular weight of 303.26 g/mol. Its IUPAC name is 2-(3-hydroxyprop-1-ynyl)-4-methyl-N-(2,2,3,3-tetrafluoropropyl)benzamide.
| Compound Name | 2-(3-hydroxyprop-1-ynyl)-4-methyl-N-(2,2,3,3-tetrafluoropropyl)benzamide |
|---|---|
| PubChem CID | 106295346 |
| Molecular Formula | C14H13F4NO2 |
| Molecular Weight | 303.26 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-(3-hydroxyprop-1-ynyl)-4-methyl-N-(2,2,3,3-tetrafluoropropyl)benzamide |
| SMILES | Cc1ccc(C(=O)NCC(F)(F)C(F)F)c(C#CCO)c1 |
| InChI | InChI=1S/C14H13F4NO2/c1-9-4-5-11(10(7-9)3-2-6-20)12(21)19-8-14(17,18)13(15)16/h4-5,7,13,20H,6,8H2,1H3,(H,19,21) |
| InChIKey | VJSRNOOMTBZBGE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|