C11H13F4N3O — CID 106295653
4-hydrazinyl-2-methyl-N-(2,2,3,3-tetrafluoropropyl)benzamide (PubChem CID 106295653) has the molecular formula C11H13F4N3O and a molecular weight of 279.24 g/mol. Its IUPAC name is 4-hydrazinyl-2-methyl-N-(2,2,3,3-tetrafluoropropyl)benzamide.
| Compound Name | 4-hydrazinyl-2-methyl-N-(2,2,3,3-tetrafluoropropyl)benzamide |
|---|---|
| PubChem CID | 106295653 |
| Molecular Formula | C11H13F4N3O |
| Molecular Weight | 279.24 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 4-hydrazinyl-2-methyl-N-(2,2,3,3-tetrafluoropropyl)benzamide |
| SMILES | Cc1cc(NN)ccc1C(=O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C11H13F4N3O/c1-6-4-7(18-16)2-3-8(6)9(19)17-5-11(14,15)10(12)13/h2-4,10,18H,5,16H2,1H3,(H,17,19) |
| InChIKey | YGYDVQJSLDVXGF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|