C14H18F4N2O — CID 106295510
4-methyl-2-(propylamino)-N-(2,2,3,3-tetrafluoropropyl)benzamide (PubChem CID 106295510) has the molecular formula C14H18F4N2O and a molecular weight of 306.30 g/mol. Its IUPAC name is 4-methyl-2-(propylamino)-N-(2,2,3,3-tetrafluoropropyl)benzamide.
| Compound Name | 4-methyl-2-(propylamino)-N-(2,2,3,3-tetrafluoropropyl)benzamide |
|---|---|
| PubChem CID | 106295510 |
| Molecular Formula | C14H18F4N2O |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 4-methyl-2-(propylamino)-N-(2,2,3,3-tetrafluoropropyl)benzamide |
| SMILES | CCCNc1cc(C)ccc1C(=O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C14H18F4N2O/c1-3-6-19-11-7-9(2)4-5-10(11)12(21)20-8-14(17,18)13(15)16/h4-5,7,13,19H,3,6,8H2,1-2H3,(H,20,21) |
| InChIKey | ULRKFMAIUPVSBM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|