C12H15F4N3O — CID 106295553
3-(propylamino)-N-(2,2,3,3-tetrafluoropropyl)pyridine-4-carboxamide (PubChem CID 106295553) has the molecular formula C12H15F4N3O and a molecular weight of 293.26 g/mol. Its IUPAC name is 3-(propylamino)-N-(2,2,3,3-tetrafluoropropyl)pyridine-4-carboxamide.
| Compound Name | 3-(propylamino)-N-(2,2,3,3-tetrafluoropropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 106295553 |
| Molecular Formula | C12H15F4N3O |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 3-(propylamino)-N-(2,2,3,3-tetrafluoropropyl)pyridine-4-carboxamide |
| SMILES | CCCNc1cnccc1C(=O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C12H15F4N3O/c1-2-4-18-9-6-17-5-3-8(9)10(20)19-7-12(15,16)11(13)14/h3,5-6,11,18H,2,4,7H2,1H3,(H,19,20) |
| InChIKey | AQGBKGBPFGEMAR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|