C11H11F4NO2 — CID 103528791
4-hydroxy-2-methyl-N-(2,2,3,3-tetrafluoropropyl)benzamide (PubChem CID 103528791) has the molecular formula C11H11F4NO2 and a molecular weight of 265.21 g/mol. Its IUPAC name is 4-hydroxy-2-methyl-N-(2,2,3,3-tetrafluoropropyl)benzamide.
| Compound Name | 4-hydroxy-2-methyl-N-(2,2,3,3-tetrafluoropropyl)benzamide |
|---|---|
| PubChem CID | 103528791 |
| Molecular Formula | C11H11F4NO2 |
| Molecular Weight | 265.21 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 4-hydroxy-2-methyl-N-(2,2,3,3-tetrafluoropropyl)benzamide |
| SMILES | Cc1cc(O)ccc1C(=O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C11H11F4NO2/c1-6-4-7(17)2-3-8(6)9(18)16-5-11(14,15)10(12)13/h2-4,10,17H,5H2,1H3,(H,16,18) |
| InChIKey | MHVRQXVUXSEPEI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.21 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|