C13H11F5N2O — CID 106295376
5-(3-aminoprop-1-ynyl)-2-fluoro-N-(2,2,3,3-tetrafluoropropyl)benzamide (PubChem CID 106295376) has the molecular formula C13H11F5N2O and a molecular weight of 306.23 g/mol. Its IUPAC name is 5-(3-aminoprop-1-ynyl)-2-fluoro-N-(2,2,3,3-tetrafluoropropyl)benzamide.
| Compound Name | 5-(3-aminoprop-1-ynyl)-2-fluoro-N-(2,2,3,3-tetrafluoropropyl)benzamide |
|---|---|
| PubChem CID | 106295376 |
| Molecular Formula | C13H11F5N2O |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 5-(3-aminoprop-1-ynyl)-2-fluoro-N-(2,2,3,3-tetrafluoropropyl)benzamide |
| SMILES | NCC#Cc1ccc(F)c(C(=O)NCC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C13H11F5N2O/c14-10-4-3-8(2-1-5-19)6-9(10)11(21)20-7-13(17,18)12(15)16/h3-4,6,12H,5,7,19H2,(H,20,21) |
| InChIKey | ADNQBGJULWFIHJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|