C13H11FN4O2 — CID 106406855
5-(3-aminoprop-1-ynyl)-2-fluoro-N-(1,2,4-oxadiazol-3-ylmethyl)benzamide (PubChem CID 106406855) has the molecular formula C13H11FN4O2 and a molecular weight of 274.26 g/mol. Its IUPAC name is 5-(3-aminoprop-1-ynyl)-2-fluoro-N-(1,2,4-oxadiazol-3-ylmethyl)benzamide.
| Compound Name | 5-(3-aminoprop-1-ynyl)-2-fluoro-N-(1,2,4-oxadiazol-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 106406855 |
| Molecular Formula | C13H11FN4O2 |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 5-(3-aminoprop-1-ynyl)-2-fluoro-N-(1,2,4-oxadiazol-3-ylmethyl)benzamide |
| SMILES | NCC#Cc1ccc(F)c(C(=O)NCc2ncon2)c1 |
| InChI | InChI=1S/C13H11FN4O2/c14-11-4-3-9(2-1-5-15)6-10(11)13(19)16-7-12-17-8-20-18-12/h3-4,6,8H,5,7,15H2,(H,16,19) |
| InChIKey | MBVJGHATFICLMW-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|