C14H12FN3O3 — CID 106406568
2-fluoro-5-(3-hydroxyprop-1-ynyl)-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]benzamide (PubChem CID 106406568) has the molecular formula C14H12FN3O3 and a molecular weight of 289.27 g/mol. Its IUPAC name is 2-fluoro-5-(3-hydroxyprop-1-ynyl)-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]benzamide.
| Compound Name | 2-fluoro-5-(3-hydroxyprop-1-ynyl)-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 106406568 |
| Molecular Formula | C14H12FN3O3 |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-fluoro-5-(3-hydroxyprop-1-ynyl)-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]benzamide |
| SMILES | Cc1nc(CNC(=O)c2cc(C#CCO)ccc2F)no1 |
| InChI | InChI=1S/C14H12FN3O3/c1-9-17-13(18-21-9)8-16-14(20)11-7-10(3-2-6-19)4-5-12(11)15/h4-5,7,19H,6,8H2,1H3,(H,16,20) |
| InChIKey | KDHLOCGHSLDLAE-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|