C13H13FN2O4 — CID 83203645
2-[[2-fluoro-5-(3-hydroxyprop-1-ynyl)benzoyl]amino]ethyl carbamate (PubChem CID 83203645) has the molecular formula C13H13FN2O4 and a molecular weight of 280.26 g/mol. Its IUPAC name is 2-[[2-fluoro-5-(3-hydroxyprop-1-ynyl)benzoyl]amino]ethyl carbamate.
| Compound Name | 2-[[2-fluoro-5-(3-hydroxyprop-1-ynyl)benzoyl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 83203645 |
| Molecular Formula | C13H13FN2O4 |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 2-[[2-fluoro-5-(3-hydroxyprop-1-ynyl)benzoyl]amino]ethyl carbamate |
| SMILES | NC(=O)OCCNC(=O)c1cc(C#CCO)ccc1F |
| InChI | InChI=1S/C13H13FN2O4/c14-11-4-3-9(2-1-6-17)8-10(11)12(18)16-5-7-20-13(15)19/h3-4,8,17H,5-7H2,(H2,15,19)(H,16,18) |
| InChIKey | OHYQTTPJXNSBIG-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|