C13H14N2O4 — CID 83203353
2-[[3-(3-hydroxyprop-1-ynyl)benzoyl]amino]ethyl carbamate (PubChem CID 83203353) has the molecular formula C13H14N2O4 and a molecular weight of 262.27 g/mol. Its IUPAC name is 2-[[3-(3-hydroxyprop-1-ynyl)benzoyl]amino]ethyl carbamate.
| Compound Name | 2-[[3-(3-hydroxyprop-1-ynyl)benzoyl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 83203353 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2-[[3-(3-hydroxyprop-1-ynyl)benzoyl]amino]ethyl carbamate |
| SMILES | NC(=O)OCCNC(=O)c1cccc(C#CCO)c1 |
| InChI | InChI=1S/C13H14N2O4/c14-13(18)19-8-6-15-12(17)11-5-1-3-10(9-11)4-2-7-16/h1,3,5,9,16H,6-8H2,(H2,14,18)(H,15,17) |
| InChIKey | PIRUFJZBCHHKLF-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|