C14H17N3O2 — CID 60865430
N-(4-amino-4-oxobutyl)-3-(3-aminoprop-1-ynyl)benzamide (PubChem CID 60865430) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is N-(4-amino-4-oxobutyl)-3-(3-aminoprop-1-ynyl)benzamide.
| Compound Name | N-(4-amino-4-oxobutyl)-3-(3-aminoprop-1-ynyl)benzamide |
|---|---|
| PubChem CID | 60865430 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | N-(4-amino-4-oxobutyl)-3-(3-aminoprop-1-ynyl)benzamide |
| SMILES | NCC#Cc1cccc(C(=O)NCCCC(N)=O)c1 |
| InChI | InChI=1S/C14H17N3O2/c15-8-2-5-11-4-1-6-12(10-11)14(19)17-9-3-7-13(16)18/h1,4,6,10H,3,7-9,15H2,(H2,16,18)(H,17,19) |
| InChIKey | VYINMCGGUWLNMM-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|