C17H18N2OS — CID 65245267
3-(3-aminoprop-1-ynyl)-N-[(4,5-dimethylthiophen-2-yl)methyl]benzamide (PubChem CID 65245267) has the molecular formula C17H18N2OS and a molecular weight of 298.41 g/mol. Its IUPAC name is 3-(3-aminoprop-1-ynyl)-N-[(4,5-dimethylthiophen-2-yl)methyl]benzamide.
| Compound Name | 3-(3-aminoprop-1-ynyl)-N-[(4,5-dimethylthiophen-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 65245267 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 3-(3-aminoprop-1-ynyl)-N-[(4,5-dimethylthiophen-2-yl)methyl]benzamide |
| SMILES | Cc1cc(CNC(=O)c2cccc(C#CCN)c2)sc1C |
| InChI | InChI=1S/C17H18N2OS/c1-12-9-16(21-13(12)2)11-19-17(20)15-7-3-5-14(10-15)6-4-8-18/h3,5,7,9-10H,8,11,18H2,1-2H3,(H,19,20) |
| InChIKey | ARTAQPFPHJWMHC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|