C15H14N2OS — CID 60821661
3-(3-aminoprop-1-ynyl)-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 60821661) has the molecular formula C15H14N2OS and a molecular weight of 270.36 g/mol. Its IUPAC name is 3-(3-aminoprop-1-ynyl)-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 3-(3-aminoprop-1-ynyl)-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 60821661 |
| Molecular Formula | C15H14N2OS |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 3-(3-aminoprop-1-ynyl)-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | NCC#Cc1cccc(C(=O)NCc2cccs2)c1 |
| InChI | InChI=1S/C15H14N2OS/c16-8-2-5-12-4-1-6-13(10-12)15(18)17-11-14-7-3-9-19-14/h1,3-4,6-7,9-10H,8,11,16H2,(H,17,18) |
| InChIKey | QUMRSIRKQIGZJC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|