C13H12N2OS2 — CID 63798987
3-(3-aminoprop-1-ynyl)-N-(thiophen-2-ylmethyl)thiophene-2-carboxamide (PubChem CID 63798987) has the molecular formula C13H12N2OS2 and a molecular weight of 276.39 g/mol. Its IUPAC name is 3-(3-aminoprop-1-ynyl)-N-(thiophen-2-ylmethyl)thiophene-2-carboxamide.
| Compound Name | 3-(3-aminoprop-1-ynyl)-N-(thiophen-2-ylmethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 63798987 |
| Molecular Formula | C13H12N2OS2 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 3-(3-aminoprop-1-ynyl)-N-(thiophen-2-ylmethyl)thiophene-2-carboxamide |
| SMILES | NCC#Cc1ccsc1C(=O)NCc1cccs1 |
| InChI | InChI=1S/C13H12N2OS2/c14-6-1-3-10-5-8-18-12(10)13(16)15-9-11-4-2-7-17-11/h2,4-5,7-8H,6,9,14H2,(H,15,16) |
| InChIKey | WWIJZPLJPONEGD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|