C14H13NO2S2 — CID 63797095
3-(3-hydroxyprop-1-ynyl)-N-(2-thiophen-2-ylethyl)thiophene-2-carboxamide (PubChem CID 63797095) has the molecular formula C14H13NO2S2 and a molecular weight of 291.40 g/mol. Its IUPAC name is 3-(3-hydroxyprop-1-ynyl)-N-(2-thiophen-2-ylethyl)thiophene-2-carboxamide.
| Compound Name | 3-(3-hydroxyprop-1-ynyl)-N-(2-thiophen-2-ylethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 63797095 |
| Molecular Formula | C14H13NO2S2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 3-(3-hydroxyprop-1-ynyl)-N-(2-thiophen-2-ylethyl)thiophene-2-carboxamide |
| SMILES | O=C(NCCc1cccs1)c1sccc1C#CCO |
| InChI | InChI=1S/C14H13NO2S2/c16-8-1-3-11-6-10-19-13(11)14(17)15-7-5-12-4-2-9-18-12/h2,4,6,9-10,16H,5,7-8H2,(H,15,17) |
| InChIKey | BPYKXQQKSPQBHQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|