C12H9N3O2S — CID 63798682
3-(3-hydroxyprop-1-ynyl)-N-pyrimidin-2-ylthiophene-2-carboxamide (PubChem CID 63798682) has the molecular formula C12H9N3O2S and a molecular weight of 259.29 g/mol. Its IUPAC name is 3-(3-hydroxyprop-1-ynyl)-N-pyrimidin-2-ylthiophene-2-carboxamide.
| Compound Name | 3-(3-hydroxyprop-1-ynyl)-N-pyrimidin-2-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 63798682 |
| Molecular Formula | C12H9N3O2S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 3-(3-hydroxyprop-1-ynyl)-N-pyrimidin-2-ylthiophene-2-carboxamide |
| SMILES | O=C(Nc1ncccn1)c1sccc1C#CCO |
| InChI | InChI=1S/C12H9N3O2S/c16-7-1-3-9-4-8-18-10(9)11(17)15-12-13-5-2-6-14-12/h2,4-6,8,16H,7H2,(H,13,14,15,17) |
| InChIKey | DPFNYVHPKIYQJZ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|