C15H12N2O3S — CID 63797944
N-(4-carbamoylphenyl)-3-(3-hydroxyprop-1-ynyl)thiophene-2-carboxamide (PubChem CID 63797944) has the molecular formula C15H12N2O3S and a molecular weight of 300.34 g/mol. Its IUPAC name is N-(4-carbamoylphenyl)-3-(3-hydroxyprop-1-ynyl)thiophene-2-carboxamide.
| Compound Name | N-(4-carbamoylphenyl)-3-(3-hydroxyprop-1-ynyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 63797944 |
| Molecular Formula | C15H12N2O3S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | N-(4-carbamoylphenyl)-3-(3-hydroxyprop-1-ynyl)thiophene-2-carboxamide |
| SMILES | NC(=O)c1ccc(NC(=O)c2sccc2C#CCO)cc1 |
| InChI | InChI=1S/C15H12N2O3S/c16-14(19)11-3-5-12(6-4-11)17-15(20)13-10(2-1-8-18)7-9-21-13/h3-7,9,18H,8H2,(H2,16,19)(H,17,20) |
| InChIKey | WBWYXDBZJFXMGE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|