C14H10F2N2OS — CID 63799155
3-(3-aminoprop-1-ynyl)-N-(3,4-difluorophenyl)thiophene-2-carboxamide (PubChem CID 63799155) has the molecular formula C14H10F2N2OS and a molecular weight of 292.31 g/mol. Its IUPAC name is 3-(3-aminoprop-1-ynyl)-N-(3,4-difluorophenyl)thiophene-2-carboxamide.
| Compound Name | 3-(3-aminoprop-1-ynyl)-N-(3,4-difluorophenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 63799155 |
| Molecular Formula | C14H10F2N2OS |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 3-(3-aminoprop-1-ynyl)-N-(3,4-difluorophenyl)thiophene-2-carboxamide |
| SMILES | NCC#Cc1ccsc1C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H10F2N2OS/c15-11-4-3-10(8-12(11)16)18-14(19)13-9(2-1-6-17)5-7-20-13/h3-5,7-8H,6,17H2,(H,18,19) |
| InChIKey | MVOCVUSVJPWGLO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|