C14H9ClFNO2S — CID 63797802
N-(3-chloro-4-fluorophenyl)-3-(3-hydroxyprop-1-ynyl)thiophene-2-carboxamide (PubChem CID 63797802) has the molecular formula C14H9ClFNO2S and a molecular weight of 309.75 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-3-(3-hydroxyprop-1-ynyl)thiophene-2-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-3-(3-hydroxyprop-1-ynyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 63797802 |
| Molecular Formula | C14H9ClFNO2S |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-3-(3-hydroxyprop-1-ynyl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)c1sccc1C#CCO |
| InChI | InChI=1S/C14H9ClFNO2S/c15-11-8-10(3-4-12(11)16)17-14(19)13-9(2-1-6-18)5-7-20-13/h3-5,7-8,18H,6H2,(H,17,19) |
| InChIKey | SCPQCPKDRSTUBO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|