C14H10ClFN2OS — CID 107370246
3-(3-aminoprop-1-ynyl)-N-(3-chloro-5-fluorophenyl)thiophene-2-carboxamide (PubChem CID 107370246) has the molecular formula C14H10ClFN2OS and a molecular weight of 308.77 g/mol. Its IUPAC name is 3-(3-aminoprop-1-ynyl)-N-(3-chloro-5-fluorophenyl)thiophene-2-carboxamide.
| Compound Name | 3-(3-aminoprop-1-ynyl)-N-(3-chloro-5-fluorophenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 107370246 |
| Molecular Formula | C14H10ClFN2OS |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 3-(3-aminoprop-1-ynyl)-N-(3-chloro-5-fluorophenyl)thiophene-2-carboxamide |
| SMILES | NCC#Cc1ccsc1C(=O)Nc1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C14H10ClFN2OS/c15-10-6-11(16)8-12(7-10)18-14(19)13-9(2-1-4-17)3-5-20-13/h3,5-8H,4,17H2,(H,18,19) |
| InChIKey | FDWKUHBEYRWKFU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|