C15H11F2NO2S — CID 63796739
N-(3,5-difluorophenyl)-3-(4-hydroxybut-1-ynyl)thiophene-2-carboxamide (PubChem CID 63796739) has the molecular formula C15H11F2NO2S and a molecular weight of 307.32 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-3-(4-hydroxybut-1-ynyl)thiophene-2-carboxamide.
| Compound Name | N-(3,5-difluorophenyl)-3-(4-hydroxybut-1-ynyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 63796739 |
| Molecular Formula | C15H11F2NO2S |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | N-(3,5-difluorophenyl)-3-(4-hydroxybut-1-ynyl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1cc(F)cc(F)c1)c1sccc1C#CCCO |
| InChI | InChI=1S/C15H11F2NO2S/c16-11-7-12(17)9-13(8-11)18-15(20)14-10(4-6-21-14)3-1-2-5-19/h4,6-9,19H,2,5H2,(H,18,20) |
| InChIKey | PAGKRZYXWSJVGP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|