C10H8N4O2S2 — CID 114913782
3-(4-hydroxybut-1-ynyl)-N-(thiatriazol-5-yl)thiophene-2-carboxamide (PubChem CID 114913782) has the molecular formula C10H8N4O2S2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 3-(4-hydroxybut-1-ynyl)-N-(thiatriazol-5-yl)thiophene-2-carboxamide.
| Compound Name | 3-(4-hydroxybut-1-ynyl)-N-(thiatriazol-5-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 114913782 |
| Molecular Formula | C10H8N4O2S2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 3-(4-hydroxybut-1-ynyl)-N-(thiatriazol-5-yl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1nnns1)c1sccc1C#CCCO |
| InChI | InChI=1S/C10H8N4O2S2/c15-5-2-1-3-7-4-6-17-8(7)9(16)11-10-12-13-14-18-10/h4,6,15H,2,5H2,(H,11,12,14,16) |
| InChIKey | DRFRMZLEINDSLS-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|