C6H5N5OS2 — CID 114911590
3-amino-N-(thiatriazol-5-yl)thiophene-2-carboxamide (PubChem CID 114911590) has the molecular formula C6H5N5OS2 and a molecular weight of 227.27 g/mol. Its IUPAC name is 3-amino-N-(thiatriazol-5-yl)thiophene-2-carboxamide.
| Compound Name | 3-amino-N-(thiatriazol-5-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 114911590 |
| Molecular Formula | C6H5N5OS2 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | 3-amino-N-(thiatriazol-5-yl)thiophene-2-carboxamide |
| SMILES | Nc1ccsc1C(=O)Nc1nnns1 |
| InChI | InChI=1S/C6H5N5OS2/c7-3-1-2-13-4(3)5(12)8-6-9-10-11-14-6/h1-2H,7H2,(H,8,9,11,12) |
| InChIKey | QVIQDRZXBRHDBV-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |