C8H7N3OS2 — CID 61090146
3-amino-N-(1,3-thiazol-2-yl)thiophene-2-carboxamide (PubChem CID 61090146) has the molecular formula C8H7N3OS2 and a molecular weight of 225.30 g/mol. Its IUPAC name is 3-amino-N-(1,3-thiazol-2-yl)thiophene-2-carboxamide.
| Compound Name | 3-amino-N-(1,3-thiazol-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 61090146 |
| Molecular Formula | C8H7N3OS2 |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.00 |
| IUPAC Name | 3-amino-N-(1,3-thiazol-2-yl)thiophene-2-carboxamide |
| SMILES | Nc1ccsc1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C8H7N3OS2/c9-5-1-3-13-6(5)7(12)11-8-10-2-4-14-8/h1-4H,9H2,(H,10,11,12) |
| InChIKey | KHQRTBDFEJDOLQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |