C11H12N4OS — CID 143922390
3-amino-2-(methylamino)-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 143922390) has the molecular formula C11H12N4OS and a molecular weight of 248.31 g/mol. Its IUPAC name is 3-amino-2-(methylamino)-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-amino-2-(methylamino)-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 143922390 |
| Molecular Formula | C11H12N4OS |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 3-amino-2-(methylamino)-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | CNc1c(N)cccc1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C11H12N4OS/c1-13-9-7(3-2-4-8(9)12)10(16)15-11-14-5-6-17-11/h2-6,13H,12H2,1H3,(H,14,15,16) |
| InChIKey | LNBPTOOSOGKJEW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|