C11H9F2N3OS — CID 55160396
3,5-difluoro-4-(methylamino)-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 55160396) has the molecular formula C11H9F2N3OS and a molecular weight of 269.28 g/mol. Its IUPAC name is 3,5-difluoro-4-(methylamino)-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 3,5-difluoro-4-(methylamino)-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 55160396 |
| Molecular Formula | C11H9F2N3OS |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 3,5-difluoro-4-(methylamino)-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | CNc1c(F)cc(C(=O)Nc2nccs2)cc1F |
| InChI | InChI=1S/C11H9F2N3OS/c1-14-9-7(12)4-6(5-8(9)13)10(17)16-11-15-2-3-18-11/h2-5,14H,1H3,(H,15,16,17) |
| InChIKey | YJXIJMMOESPRRA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |