C13H15N3OS — CID 63107522
2-(propan-2-ylamino)-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 63107522) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is 2-(propan-2-ylamino)-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-(propan-2-ylamino)-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 63107522 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 2-(propan-2-ylamino)-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | CC(C)Nc1ccccc1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C13H15N3OS/c1-9(2)15-11-6-4-3-5-10(11)12(17)16-13-14-7-8-18-13/h3-9,15H,1-2H3,(H,14,16,17) |
| InChIKey | LGBLHDYRGCHBDL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |