C12H12N2O3S2 — CID 7295168
2-ethylsulfonyl-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 7295168) has the molecular formula C12H12N2O3S2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-ethylsulfonyl-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-ethylsulfonyl-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 7295168 |
| Molecular Formula | C12H12N2O3S2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 2-ethylsulfonyl-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | CCS(=O)(=O)c1ccccc1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C12H12N2O3S2/c1-2-19(16,17)10-6-4-3-5-9(10)11(15)14-12-13-7-8-18-12/h3-8H,2H2,1H3,(H,13,14,15) |
| InChIKey | WVNWVQZOONEZCV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |