C16H12Cl2N2O3S2 — CID 18577011
N-(4,7-dichloro-1,3-benzothiazol-2-yl)-2-ethylsulfonylbenzamide (PubChem CID 18577011) has the molecular formula C16H12Cl2N2O3S2 and a molecular weight of 415.32 g/mol. Its IUPAC name is N-(4,7-dichloro-1,3-benzothiazol-2-yl)-2-ethylsulfonylbenzamide.
| Compound Name | N-(4,7-dichloro-1,3-benzothiazol-2-yl)-2-ethylsulfonylbenzamide |
|---|---|
| PubChem CID | 18577011 |
| Molecular Formula | C16H12Cl2N2O3S2 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 413.97 |
| IUPAC Name | N-(4,7-dichloro-1,3-benzothiazol-2-yl)-2-ethylsulfonylbenzamide |
| SMILES | CCS(=O)(=O)c1ccccc1C(=O)Nc1nc2c(Cl)ccc(Cl)c2s1 |
| InChI | InChI=1S/C16H12Cl2N2O3S2/c1-2-25(22,23)12-6-4-3-5-9(12)15(21)20-16-19-13-10(17)7-8-11(18)14(13)24-16/h3-8H,2H2,1H3,(H,19,20,21) |
| InChIKey | NWYJWNYSMLKIEB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |