C19H17FN2O3S2 — CID 28543180
2-ethylsulfonyl-N-[4-(4-fluorophenyl)-5-methyl-1,3-thiazol-2-yl]benzamide (PubChem CID 28543180) has the molecular formula C19H17FN2O3S2 and a molecular weight of 404.49 g/mol. Its IUPAC name is 2-ethylsulfonyl-N-[4-(4-fluorophenyl)-5-methyl-1,3-thiazol-2-yl]benzamide.
| Compound Name | 2-ethylsulfonyl-N-[4-(4-fluorophenyl)-5-methyl-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 28543180 |
| Molecular Formula | C19H17FN2O3S2 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 2-ethylsulfonyl-N-[4-(4-fluorophenyl)-5-methyl-1,3-thiazol-2-yl]benzamide |
| SMILES | CCS(=O)(=O)c1ccccc1C(=O)Nc1nc(-c2ccc(F)cc2)c(C)s1 |
| InChI | InChI=1S/C19H17FN2O3S2/c1-3-27(24,25)16-7-5-4-6-15(16)18(23)22-19-21-17(12(2)26-19)13-8-10-14(20)11-9-13/h4-11H,3H2,1-2H3,(H,21,22,23) |
| InChIKey | DUEVTJXHAFBYEB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |