C15H17FN2OS — CID 19210425
N-[4-(4-fluorophenyl)-5-methyl-1,3-thiazol-2-yl]pentanamide (PubChem CID 19210425) has the molecular formula C15H17FN2OS and a molecular weight of 292.38 g/mol. Its IUPAC name is N-[4-(4-fluorophenyl)-5-methyl-1,3-thiazol-2-yl]pentanamide.
| Compound Name | N-[4-(4-fluorophenyl)-5-methyl-1,3-thiazol-2-yl]pentanamide |
|---|---|
| PubChem CID | 19210425 |
| Molecular Formula | C15H17FN2OS |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | N-[4-(4-fluorophenyl)-5-methyl-1,3-thiazol-2-yl]pentanamide |
| SMILES | CCCCC(=O)Nc1nc(-c2ccc(F)cc2)c(C)s1 |
| InChI | InChI=1S/C15H17FN2OS/c1-3-4-5-13(19)17-15-18-14(10(2)20-15)11-6-8-12(16)9-7-11/h6-9H,3-5H2,1-2H3,(H,17,18,19) |
| InChIKey | VVYAWNZJHPTNPD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |