C14H13FN2O3S — CID 94970416
2-(butanoylamino)-4-(4-fluorophenyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 94970416) has the molecular formula C14H13FN2O3S and a molecular weight of 308.33 g/mol. Its IUPAC name is 2-(butanoylamino)-4-(4-fluorophenyl)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(butanoylamino)-4-(4-fluorophenyl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 94970416 |
| Molecular Formula | C14H13FN2O3S |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 2-(butanoylamino)-4-(4-fluorophenyl)-1,3-thiazole-5-carboxylic acid |
| SMILES | CCCC(=O)Nc1nc(-c2ccc(F)cc2)c(C(=O)O)s1 |
| InChI | InChI=1S/C14H13FN2O3S/c1-2-3-10(18)16-14-17-11(12(21-14)13(19)20)8-4-6-9(15)7-5-8/h4-7H,2-3H2,1H3,(H,19,20)(H,16,17,18) |
| InChIKey | WBLYXVVHDXDDDU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |