C22H18FN3O3S — CID 19219149
4-(1,3-dioxoisoindol-2-yl)-N-[4-(4-fluorophenyl)-5-methyl-1,3-thiazol-2-yl]butanamide (PubChem CID 19219149) has the molecular formula C22H18FN3O3S and a molecular weight of 423.47 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-[4-(4-fluorophenyl)-5-methyl-1,3-thiazol-2-yl]butanamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-[4-(4-fluorophenyl)-5-methyl-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 19219149 |
| Molecular Formula | C22H18FN3O3S |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-[4-(4-fluorophenyl)-5-methyl-1,3-thiazol-2-yl]butanamide |
| SMILES | Cc1sc(NC(=O)CCCN2C(=O)c3ccccc3C2=O)nc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H18FN3O3S/c1-13-19(14-8-10-15(23)11-9-14)25-22(30-13)24-18(27)7-4-12-26-20(28)16-5-2-3-6-17(16)21(26)29/h2-3,5-6,8-11H,4,7,12H2,1H3,(H,24,25,27) |
| InChIKey | NVFNONHIZOOHOJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|