C25H24BrN3O3S — CID 19228364
N-[4-(4-bromophenyl)-5-ethyl-1,3-thiazol-2-yl]-6-(1,3-dioxoisoindol-2-yl)hexanamide (PubChem CID 19228364) has the molecular formula C25H24BrN3O3S and a molecular weight of 526.46 g/mol. Its IUPAC name is N-[4-(4-bromophenyl)-5-ethyl-1,3-thiazol-2-yl]-6-(1,3-dioxoisoindol-2-yl)hexanamide.
| Compound Name | N-[4-(4-bromophenyl)-5-ethyl-1,3-thiazol-2-yl]-6-(1,3-dioxoisoindol-2-yl)hexanamide |
|---|---|
| PubChem CID | 19228364 |
| Molecular Formula | C25H24BrN3O3S |
| Molecular Weight | 526.46 g/mol |
| Exact Mass | 525.07 |
| IUPAC Name | N-[4-(4-bromophenyl)-5-ethyl-1,3-thiazol-2-yl]-6-(1,3-dioxoisoindol-2-yl)hexanamide |
| SMILES | CCc1sc(NC(=O)CCCCCN2C(=O)c3ccccc3C2=O)nc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C25H24BrN3O3S/c1-2-20-22(16-11-13-17(26)14-12-16)28-25(33-20)27-21(30)10-4-3-7-15-29-23(31)18-8-5-6-9-19(18)24(29)32/h5-6,8-9,11-14H,2-4,7,10,15H2,1H3,(H,27,28,30) |
| InChIKey | GBZIOHAFJNHNLW-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.46 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|