C19H17BrN2O2S — CID 19226508
N-[4-(4-bromophenyl)-5-ethyl-1,3-thiazol-2-yl]-2-methoxybenzamide (PubChem CID 19226508) has the molecular formula C19H17BrN2O2S and a molecular weight of 417.33 g/mol. Its IUPAC name is N-[4-(4-bromophenyl)-5-ethyl-1,3-thiazol-2-yl]-2-methoxybenzamide.
| Compound Name | N-[4-(4-bromophenyl)-5-ethyl-1,3-thiazol-2-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 19226508 |
| Molecular Formula | C19H17BrN2O2S |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | N-[4-(4-bromophenyl)-5-ethyl-1,3-thiazol-2-yl]-2-methoxybenzamide |
| SMILES | CCc1sc(NC(=O)c2ccccc2OC)nc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H17BrN2O2S/c1-3-16-17(12-8-10-13(20)11-9-12)21-19(25-16)22-18(23)14-6-4-5-7-15(14)24-2/h4-11H,3H2,1-2H3,(H,21,22,23) |
| InChIKey | JCPCIOWXFSLOBN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |