C25H21BrN2OS — CID 19226363
N-[4-(4-bromophenyl)-5-ethyl-1,3-thiazol-2-yl]-2,2-diphenylacetamide (PubChem CID 19226363) has the molecular formula C25H21BrN2OS and a molecular weight of 477.43 g/mol. Its IUPAC name is N-[4-(4-bromophenyl)-5-ethyl-1,3-thiazol-2-yl]-2,2-diphenylacetamide.
| Compound Name | N-[4-(4-bromophenyl)-5-ethyl-1,3-thiazol-2-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 19226363 |
| Molecular Formula | C25H21BrN2OS |
| Molecular Weight | 477.43 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | N-[4-(4-bromophenyl)-5-ethyl-1,3-thiazol-2-yl]-2,2-diphenylacetamide |
| SMILES | CCc1sc(NC(=O)C(c2ccccc2)c2ccccc2)nc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C25H21BrN2OS/c1-2-21-23(19-13-15-20(26)16-14-19)27-25(30-21)28-24(29)22(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-16,22H,2H2,1H3,(H,27,28,29) |
| InChIKey | USHQQKSTDGPOKO-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.43 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |