C24H27BrN2O2S — CID 19229213
N-[4-(4-bromophenyl)-5-ethyl-1,3-thiazol-2-yl]-4-(4-propan-2-ylphenoxy)butanamide (PubChem CID 19229213) has the molecular formula C24H27BrN2O2S and a molecular weight of 487.46 g/mol. Its IUPAC name is N-[4-(4-bromophenyl)-5-ethyl-1,3-thiazol-2-yl]-4-(4-propan-2-ylphenoxy)butanamide.
| Compound Name | N-[4-(4-bromophenyl)-5-ethyl-1,3-thiazol-2-yl]-4-(4-propan-2-ylphenoxy)butanamide |
|---|---|
| PubChem CID | 19229213 |
| Molecular Formula | C24H27BrN2O2S |
| Molecular Weight | 487.46 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | N-[4-(4-bromophenyl)-5-ethyl-1,3-thiazol-2-yl]-4-(4-propan-2-ylphenoxy)butanamide |
| SMILES | CCc1sc(NC(=O)CCCOc2ccc(C(C)C)cc2)nc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H27BrN2O2S/c1-4-21-23(18-7-11-19(25)12-8-18)27-24(30-21)26-22(28)6-5-15-29-20-13-9-17(10-14-20)16(2)3/h7-14,16H,4-6,15H2,1-3H3,(H,26,27,28) |
| InChIKey | FYJDLILXZAVJFL-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.46 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|