C26H28BrNO4S — CID 19229219
methyl 4-(4-bromophenyl)-5-methyl-2-[4-(4-propan-2-ylphenoxy)butanoylamino]thiophene-3-carboxylate (PubChem CID 19229219) has the molecular formula C26H28BrNO4S and a molecular weight of 530.48 g/mol. Its IUPAC name is methyl 4-(4-bromophenyl)-5-methyl-2-[4-(4-propan-2-ylphenoxy)butanoylamino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-bromophenyl)-5-methyl-2-[4-(4-propan-2-ylphenoxy)butanoylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19229219 |
| Molecular Formula | C26H28BrNO4S |
| Molecular Weight | 530.48 g/mol |
| Exact Mass | 529.09 |
| IUPAC Name | methyl 4-(4-bromophenyl)-5-methyl-2-[4-(4-propan-2-ylphenoxy)butanoylamino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CCCOc2ccc(C(C)C)cc2)sc(C)c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C26H28BrNO4S/c1-16(2)18-9-13-21(14-10-18)32-15-5-6-22(29)28-25-24(26(30)31-4)23(17(3)33-25)19-7-11-20(27)12-8-19/h7-14,16H,5-6,15H2,1-4H3,(H,28,29) |
| InChIKey | JJXIBPQADNMWHP-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.48 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|