C26H29NO3S — CID 19221557
ethyl 5-methyl-4-phenyl-2-[3-(4-propan-2-ylphenyl)propanoylamino]thiophene-3-carboxylate (PubChem CID 19221557) has the molecular formula C26H29NO3S and a molecular weight of 435.59 g/mol. Its IUPAC name is ethyl 5-methyl-4-phenyl-2-[3-(4-propan-2-ylphenyl)propanoylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-methyl-4-phenyl-2-[3-(4-propan-2-ylphenyl)propanoylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19221557 |
| Molecular Formula | C26H29NO3S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | ethyl 5-methyl-4-phenyl-2-[3-(4-propan-2-ylphenyl)propanoylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CCc2ccc(C(C)C)cc2)sc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C26H29NO3S/c1-5-30-26(29)24-23(21-9-7-6-8-10-21)18(4)31-25(24)27-22(28)16-13-19-11-14-20(15-12-19)17(2)3/h6-12,14-15,17H,5,13,16H2,1-4H3,(H,27,28) |
| InChIKey | NQLZOYPHUGBMMF-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|