C22H21ClN2O2S — CID 55774775
2-[4-(4-chlorophenyl)butanoylamino]-5-methyl-4-phenylthiophene-3-carboxamide (PubChem CID 55774775) has the molecular formula C22H21ClN2O2S and a molecular weight of 412.94 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)butanoylamino]-5-methyl-4-phenylthiophene-3-carboxamide.
| Compound Name | 2-[4-(4-chlorophenyl)butanoylamino]-5-methyl-4-phenylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 55774775 |
| Molecular Formula | C22H21ClN2O2S |
| Molecular Weight | 412.94 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 2-[4-(4-chlorophenyl)butanoylamino]-5-methyl-4-phenylthiophene-3-carboxamide |
| SMILES | Cc1sc(NC(=O)CCCc2ccc(Cl)cc2)c(C(N)=O)c1-c1ccccc1 |
| InChI | InChI=1S/C22H21ClN2O2S/c1-14-19(16-7-3-2-4-8-16)20(21(24)27)22(28-14)25-18(26)9-5-6-15-10-12-17(23)13-11-15/h2-4,7-8,10-13H,5-6,9H2,1H3,(H2,24,27)(H,25,26) |
| InChIKey | UFMYDYNUAVMZOW-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.94 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |