C23H22ClN3O3S — CID 55572331
2-[4-[(4-chlorobenzoyl)amino]butanoylamino]-5-methyl-4-phenylthiophene-3-carboxamide (PubChem CID 55572331) has the molecular formula C23H22ClN3O3S and a molecular weight of 455.97 g/mol. Its IUPAC name is 2-[4-[(4-chlorobenzoyl)amino]butanoylamino]-5-methyl-4-phenylthiophene-3-carboxamide.
| Compound Name | 2-[4-[(4-chlorobenzoyl)amino]butanoylamino]-5-methyl-4-phenylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 55572331 |
| Molecular Formula | C23H22ClN3O3S |
| Molecular Weight | 455.97 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 2-[4-[(4-chlorobenzoyl)amino]butanoylamino]-5-methyl-4-phenylthiophene-3-carboxamide |
| SMILES | Cc1sc(NC(=O)CCCNC(=O)c2ccc(Cl)cc2)c(C(N)=O)c1-c1ccccc1 |
| InChI | InChI=1S/C23H22ClN3O3S/c1-14-19(15-6-3-2-4-7-15)20(21(25)29)23(31-14)27-18(28)8-5-13-26-22(30)16-9-11-17(24)12-10-16/h2-4,6-7,9-12H,5,8,13H2,1H3,(H2,25,29)(H,26,30)(H,27,28) |
| InChIKey | UYVRWMURYSMODZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.97 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|