C22H21ClN2O2S2 — CID 19649674
methyl 2-[2-(4-chlorophenyl)ethylcarbamothioylamino]-5-methyl-4-phenylthiophene-3-carboxylate (PubChem CID 19649674) has the molecular formula C22H21ClN2O2S2 and a molecular weight of 445.01 g/mol. Its IUPAC name is methyl 2-[2-(4-chlorophenyl)ethylcarbamothioylamino]-5-methyl-4-phenylthiophene-3-carboxylate.
| Compound Name | methyl 2-[2-(4-chlorophenyl)ethylcarbamothioylamino]-5-methyl-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19649674 |
| Molecular Formula | C22H21ClN2O2S2 |
| Molecular Weight | 445.01 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | methyl 2-[2-(4-chlorophenyl)ethylcarbamothioylamino]-5-methyl-4-phenylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)NCCc2ccc(Cl)cc2)sc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C22H21ClN2O2S2/c1-14-18(16-6-4-3-5-7-16)19(21(26)27-2)20(29-14)25-22(28)24-13-12-15-8-10-17(23)11-9-15/h3-11H,12-13H2,1-2H3,(H2,24,25,28) |
| InChIKey | ZIVFJPMKLZVFGK-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.01 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|