C22H30N2O2S2 — CID 19651805
methyl 2-(2-ethylhexylcarbamothioylamino)-5-methyl-4-phenylthiophene-3-carboxylate (PubChem CID 19651805) has the molecular formula C22H30N2O2S2 and a molecular weight of 418.63 g/mol. Its IUPAC name is methyl 2-(2-ethylhexylcarbamothioylamino)-5-methyl-4-phenylthiophene-3-carboxylate.
| Compound Name | methyl 2-(2-ethylhexylcarbamothioylamino)-5-methyl-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19651805 |
| Molecular Formula | C22H30N2O2S2 |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | methyl 2-(2-ethylhexylcarbamothioylamino)-5-methyl-4-phenylthiophene-3-carboxylate |
| SMILES | CCCCC(CC)CNC(=S)Nc1sc(C)c(-c2ccccc2)c1C(=O)OC |
| InChI | InChI=1S/C22H30N2O2S2/c1-5-7-11-16(6-2)14-23-22(27)24-20-19(21(25)26-4)18(15(3)28-20)17-12-9-8-10-13-17/h8-10,12-13,16H,5-7,11,14H2,1-4H3,(H2,23,24,27) |
| InChIKey | UIZBQAVEXSABMP-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|