C19H21ClN2O2S2 — CID 19649665
methyl 2-[2-(4-chlorophenyl)ethylcarbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19649665) has the molecular formula C19H21ClN2O2S2 and a molecular weight of 408.98 g/mol. Its IUPAC name is methyl 2-[2-(4-chlorophenyl)ethylcarbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[2-(4-chlorophenyl)ethylcarbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19649665 |
| Molecular Formula | C19H21ClN2O2S2 |
| Molecular Weight | 408.98 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | methyl 2-[2-(4-chlorophenyl)ethylcarbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)NCCc2ccc(Cl)cc2)sc2c1CCCC2 |
| InChI | InChI=1S/C19H21ClN2O2S2/c1-24-18(23)16-14-4-2-3-5-15(14)26-17(16)22-19(25)21-11-10-12-6-8-13(20)9-7-12/h6-9H,2-5,10-11H2,1H3,(H2,21,22,25) |
| InChIKey | LMHDTMUUHFWJLE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.98 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|