C27H30FNO4S — CID 19228172
methyl 2-[4-(4-tert-butylphenoxy)butanoylamino]-4-(4-fluorophenyl)-5-methylthiophene-3-carboxylate (PubChem CID 19228172) has the molecular formula C27H30FNO4S and a molecular weight of 483.61 g/mol. Its IUPAC name is methyl 2-[4-(4-tert-butylphenoxy)butanoylamino]-4-(4-fluorophenyl)-5-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[4-(4-tert-butylphenoxy)butanoylamino]-4-(4-fluorophenyl)-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19228172 |
| Molecular Formula | C27H30FNO4S |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | methyl 2-[4-(4-tert-butylphenoxy)butanoylamino]-4-(4-fluorophenyl)-5-methylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CCCOc2ccc(C(C)(C)C)cc2)sc(C)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C27H30FNO4S/c1-17-23(18-8-12-20(28)13-9-18)24(26(31)32-5)25(34-17)29-22(30)7-6-16-33-21-14-10-19(11-15-21)27(2,3)4/h8-15H,6-7,16H2,1-5H3,(H,29,30) |
| InChIKey | NYASJICIICMKLH-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|