C22H19BrFNO4S — CID 19199895
methyl 2-[[2-(4-bromo-3-methylphenoxy)acetyl]amino]-4-(4-fluorophenyl)-5-methylthiophene-3-carboxylate (PubChem CID 19199895) has the molecular formula C22H19BrFNO4S and a molecular weight of 492.37 g/mol. Its IUPAC name is methyl 2-[[2-(4-bromo-3-methylphenoxy)acetyl]amino]-4-(4-fluorophenyl)-5-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-(4-bromo-3-methylphenoxy)acetyl]amino]-4-(4-fluorophenyl)-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19199895 |
| Molecular Formula | C22H19BrFNO4S |
| Molecular Weight | 492.37 g/mol |
| Exact Mass | 491.02 |
| IUPAC Name | methyl 2-[[2-(4-bromo-3-methylphenoxy)acetyl]amino]-4-(4-fluorophenyl)-5-methylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)COc2ccc(Br)c(C)c2)sc(C)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H19BrFNO4S/c1-12-10-16(8-9-17(12)23)29-11-18(26)25-21-20(22(27)28-3)19(13(2)30-21)14-4-6-15(24)7-5-14/h4-10H,11H2,1-3H3,(H,25,26) |
| InChIKey | KCLYKZASGCDMHY-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.37 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|